On Target RT_HIV1 0.27966103/CHEMBL3775172
For the given ligand DB00838, we have found in our database that, being scored 0.27966103, the most similar ligand is CHEMBL3775172. Check out the elaboration below.
| DB00838 (Given Ligand) | CHEMBL3775172 (Similar Ligand) |
|---|---|
| C[C@H]4C[C@H]3[C@H]2C[C@@H](F)/C1=C/C(=O)/C=C\[C@@]1(C)[C@]2(Cl)[C@@H](O)C[C@]3(C)[C@H]4C(=O)CO | C=C(C)[C@@H]1CC[C@]2(C(=O)O)CC[C@]3(C)[C@H](CC[C@@H]4[C@@]5(C)CC=C(c6ccc(C(=O)O)cc6)C(C)(C)[C@@H]5CC[C@]43C)[C@@H]12 |
|
|
|
|
|
|
| 000b0002 81000000 00100000 00080000 00981400 00000000 00000080 02000402 01000000 00100000 00000401 40005000 04028028 00800000 00000400 08080008 00000000 00002000 02412000 00022001 00000001 80000380 01008000 00100810 00200000 08000020 00404020 b0000008 00800000 03000000 24020000 00820a00 | 00010000 01000800 00000302 40050200 00080000 00004000 80000080 00000402 00000900 00188848 08100000 40009800 04028008 00a00000 00000402 00080008 00000400 02000020 02402000 00000001 01000100 08020a20 01008020 00400014 01200000 80000000 00406000 c0000000 00400002 01020002 e4020000 00000400 |