On Target RT_HIV1 0.3139535/CHEMBL404519
For the given ligand DB00663, we have found in our database that, being scored 0.3139535, the most similar ligand is CHEMBL404519. Check out the elaboration below.
| DB00663 (Given Ligand) | CHEMBL404519 (Similar Ligand) |
|---|---|
| C[C@@H]4C[C@@H]3[C@@H]2C[C@@H](F)/C1=C/C(=O)/C=C\[C@@]1(C)[C@]2(F)[C@@H](O)C[C@]3(C)[C@]4(O)C(=O)CO | C=C(C)[C@@H]1CC[C@]2(C(=O)O)CC[C@]3(C)[C@H](CC[C@@H]4[C@@]5(C)CC[C@H](OC(=O)CC(C)(C)C(=O)O)C(C)(C)[C@@H]5CC[C@]43C)[C@@H]12 |
|
|
|
|
|
|
| 00010002 81400000 00100000 00081000 00281400 00000000 00000080 02000402 01000000 00100000 00000001 40005000 04028028 00800000 00000400 08080008 00000000 00000000 03412000 00022001 00000001 00000280 01008000 00520810 00200000 00000022 00404020 b0000000 00000000 13000000 24020000 00000200 | 00050040 01000000 00000100 00010300 00280000 00000000 00000000 00000400 00000000 00108008 00000000 40009000 04008008 00800000 00000400 00081008 00820000 00000100 12402000 00000001 00000020 00000a00 01000000 00000010 00000400 00000000 00000000 80000000 00000202 01000002 24020000 00000000 |