On Target NS5B_HCV1A 0.30769232/CHEMBL367415
For the given ligand DB00984, we have found in our database that, being scored 0.30769232, the most similar ligand is CHEMBL367415. Check out the elaboration below.
| DB00984 (Given Ligand) | CHEMBL367415 (Similar Ligand) |
|---|---|
| C[C@@]34CC[C@H]2[C@H]1CCC(=O)/C=C1/CC[C@@H]2[C@@H]3CC[C@@H]4OC(=O)CCc5ccccc5 | N#Cc1c(Cl)cccc1-c1cccc(C(=O)CC(=O)C(=O)O)c1 |
|
|
|
|
|
|
| 00010040 01000008 00000100 00010300 00080000 00000000 00000080 00000402 01000800 00188840 08100000 40009000 04028008 00800000 00000400 00081008 00820000 02000020 02412008 00000001 00000120 08000a80 01008040 00400010 00200c00 80000000 00404000 80000000 00000200 01020002 24020000 00000400 | 0005a000 01000801 00000102 00810200 00080021 00000000 04000000 00000000 04100900 00880840 08100000 4001d800 06008004 00200008 a0000000 08082008 00420000 02001000 04c00008 00002001 00000100 08020b00 11000480 00400014 00002800 80000280 00000000 00000041 10004002 00020402 80000000 00420400 |