On Target NS5B_HCV1A 0.4516129/CHEMBL446360
For the given ligand DB00374, we have found in our database that, being scored 0.4516129, the most similar ligand is CHEMBL446360. Check out the elaboration below.
| DB00374 (Given Ligand) | CHEMBL446360 (Similar Ligand) |
|---|---|
| CCCCC[C@@H](O)CC[C@@H]3[C@@H](O)C[C@H]2Cc1c(cccc1OCC(=O)O)C[C@H]23 | N#Cc1ccc(Br)cc1Oc1ccccc1C(=O)CC(=O)C(=O)O |
|
|
|
|
|
|
| 04000000 43000008 2000010a 00010200 00081000 c0000002 02000000 00000201 00010810 00080840 08140000 4000c040 00808002 22a00080 01200021 00082008 00000200 82008000 00482000 00020201 00000100 08000a00 05004000 08400410 00000000 c0000001 00000008 00800000 00000302 01024002 00020000 00000400 | 00054004 01008808 2000010a 00018200 00081020 00020002 06404000 00000201 04000904 00880840 0814000a 4000d040 04008012 00200000 01000001 00082008 00400000 02000000 00c02008 00020001 00400100 08020a00 01000400 00400414 00000800 c0000000 00120800 00200000 00000302 00064422 81020408 08400400 |