On Target NS5B_HCV1A 0.21167883/CHEMBL163917
For the given ligand DB00838, we have found in our database that, being scored 0.21167883, the most similar ligand is CHEMBL163917. Check out the elaboration below.
| DB00838 (Given Ligand) | CHEMBL163917 (Similar Ligand) |
|---|---|
| C[C@H]4C[C@H]3[C@H]2C[C@@H](F)/C1=C/C(=O)/C=C\[C@@]1(C)[C@]2(Cl)[C@@H](O)C[C@]3(C)[C@H]4C(=O)CO | CC(C)C[C@H](NC(=O)[C@H](CCC(=O)O)NC(=O)OC(C)(C)C)C(=O)N[C@@H](CC(F)F)C(=O)C(=O)O |
|
|
|
|
|
|
| 000b0002 81000000 00100000 00080000 00981400 00000000 00000080 02000402 01000000 00100000 00000401 40005000 04028028 00800000 00000400 08080008 00000000 00002000 02412000 00022001 00000001 80000380 01008000 00100810 00200000 08000020 00404020 b0000008 00800000 03000000 24020000 00820a00 | 00030000 01403000 00100000 04000600 00181000 00018000 00000000 20000008 04800200 00020080 00200000 4001f000 0e008032 01002001 80000000 001a0408 000a0000 00080001 00c00810 00000201 00000000 30140e50 01000083 02100018 00001001 00000082 00000060 90200020 08000200 02040001 a0004000 00802a00 |