On Target NA_INFB 0.24844721/CHEMBL362993
For the given ligand DB00374, we have found in our database that, being scored 0.24844721, the most similar ligand is CHEMBL362993. Check out the elaboration below.
| DB00374 (Given Ligand) | CHEMBL362993 (Similar Ligand) |
|---|---|
| CCCCC[C@@H](O)CC[C@@H]3[C@@H](O)C[C@H]2Cc1c(cccc1OCC(=O)O)C[C@H]23 | CC(=O)N[C@@H](CC(C)C)[C@@H]1N[C@@H](C(=O)O)C[C@H]1c1cc[nH]n1 |
|
|
|
|
|
|
| 04000000 43000008 2000010a 00010200 00081000 c0000002 02000000 00000201 00010810 00080840 08140000 4000c040 00808002 22a00080 01200021 00082008 00000200 82008000 00482000 00020201 00000100 08000a00 05004000 08400410 00000000 c0000001 00000008 00800000 00000302 01024002 00020000 00000400 | 04010000 01003208 20100102 04000600 01080080 00000012 00000020 20000208 00000880 000c0080 00308000 400130c0 1e00801a 01a02001 81180000 000c200c 90000000 0e000000 00402000 00220241 00100000 32240e30 07800801 03100018 00002000 00000000 00120000 10000180 0c000006 0006c00b 00024000 00c02e20 |