On Target NA_INFB 0.3030303/CHEMBL420120
For the given ligand DB00838, we have found in our database that, being scored 0.3030303, the most similar ligand is CHEMBL420120. Check out the elaboration below.
| DB00838 (Given Ligand) | CHEMBL420120 (Similar Ligand) |
|---|---|
| C[C@H]4C[C@H]3[C@H]2C[C@@H](F)/C1=C/C(=O)/C=C\[C@@]1(C)[C@]2(Cl)[C@@H](O)C[C@]3(C)[C@H]4C(=O)CO | CCCN(CCC)[C@@H]1C=C(C(=O)O)C[C@H](N)[C@H]1NC(C)=O |
|
|
|
|
|
|
| 000b0002 81000000 00100000 00080000 00981400 00000000 00000080 02000402 01000000 00100000 00000401 40005000 04028028 00800000 00000400 08080008 00000000 00002000 02412000 00022001 00000001 80000380 01008000 00100810 00200000 08000020 00404020 b0000008 00800000 03000000 24020000 00820a00 | 00030010 0900b400 00100000 04000400 00180000 00000000 00180180 3800040a 11000000 00100188 00200000 41011000 0402811a 01812000 00000400 00080308 20004000 00000160 40412010 00000201 00000000 30040f90 01008001 02100018 00001000 08008c00 00484000 90000000 0c000000 00040411 04020000 02002200 |