On Target NP_HCoV-OC43 0.08148148/CHEMBL3233481
For the given ligand DB00374, we have found in our database that, being scored 0.08148148, the most similar ligand is CHEMBL3233481. Check out the elaboration below.
| DB00374 (Given Ligand) | CHEMBL3233481 (Similar Ligand) |
|---|---|
| CCCCC[C@@H](O)CC[C@@H]3[C@@H](O)C[C@H]2Cc1c(cccc1OCC(=O)O)C[C@H]23 | CN(C)CC(=O)Nc1ccc2[nH]c(=O)c3ccccc3c2c1.Cl |
|
|
|
|
|
|
| 04000000 43000008 2000010a 00010200 00081000 c0000002 02000000 00000201 00010810 00080840 08140000 4000c040 00808002 22a00080 01200021 00082008 00000200 82008000 00482000 00020201 00000100 08000a00 05004000 08400410 00000000 c0000001 00000008 00800000 00000302 01024002 00020000 00000400 | 00004002 00800000 00004020 00000600 00040000 00000060 00000000 00000000 06000000 40000a60 04280004 4000a000 00008800 00702000 00100040 00040004 00040000 00000008 08200000 00000004 40100000 28008608 20802000 80100002 00000000 40000000 00000000 00000080 08008000 00060001 00044000 00020200 |