On Target NP_HCoV-OC43 0.054263566/CHEMBL3233481
For the given ligand DB00838, we have found in our database that, being scored 0.054263566, the most similar ligand is CHEMBL3233481. Check out the elaboration below.
| DB00838 (Given Ligand) | CHEMBL3233481 (Similar Ligand) |
|---|---|
| C[C@H]4C[C@H]3[C@H]2C[C@@H](F)/C1=C/C(=O)/C=C\[C@@]1(C)[C@]2(Cl)[C@@H](O)C[C@]3(C)[C@H]4C(=O)CO | CN(C)CC(=O)Nc1ccc2[nH]c(=O)c3ccccc3c2c1.Cl |
|
|
|
|
|
|
| 000b0002 81000000 00100000 00080000 00981400 00000000 00000080 02000402 01000000 00100000 00000401 40005000 04028028 00800000 00000400 08080008 00000000 00002000 02412000 00022001 00000001 80000380 01008000 00100810 00200000 08000020 00404020 b0000008 00800000 03000000 24020000 00820a00 | 00004002 00800000 00004020 00000600 00040000 00000060 00000000 00000000 06000000 40000a60 04280004 4000a000 00008800 00702000 00100040 00040004 00040000 00000008 08200000 00000004 40100000 28008608 20802000 80100002 00000000 40000000 00000000 00000080 08008000 00060001 00044000 00020200 |