On Target PLP_SARS 0.27096775/CHEMBL213543
For the given ligand DB00984, we have found in our database that, being scored 0.27096775, the most similar ligand is CHEMBL213543. Check out the elaboration below.
| DB00984 (Given Ligand) | CHEMBL213543 (Similar Ligand) |
|---|---|
| C[C@@]34CC[C@H]2[C@H]1CCC(=O)/C=C1/CC[C@@H]2[C@@H]3CC[C@@H]4OC(=O)CCc5ccccc5 | CCOC(=O)/C=C/[C@H](C[C@@H]1CCNC1=O)NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](NC(=O)OCc1ccccc1)C(C)C |
|
|
|
|
|
|
| 00010040 01000008 00000100 00010300 00080000 00000000 00000080 00000402 01000800 00188840 08100000 40009000 04028008 00800000 00000400 00081008 00820000 02000020 02412008 00000001 00000120 08000a80 01008040 00400010 00200c00 80000000 00404000 80000000 00000200 01020002 24020000 00000400 | 01030000 0140b000 00100100 04010600 00000000 0001c810 02100080 28000408 01a00300 001088c0 40200000 4003b000 0e028002 00012001 80000400 021a0008 20020000 02080500 20012890 00001201 00002000 38040fb0 00008003 02500018 00001400 8800ac02 00484000 90200120 08000200 00060001 ec004000 02802210 |