On Target PLP_SARS 0.22068965/CHEMBL222735
For the given ligand DB00374, we have found in our database that, being scored 0.22068965, the most similar ligand is CHEMBL222735. Check out the elaboration below.
| DB00374 (Given Ligand) | CHEMBL222735 (Similar Ligand) |
|---|---|
| CCCCC[C@@H](O)CC[C@@H]3[C@@H](O)C[C@H]2Cc1c(cccc1OCC(=O)O)C[C@H]23 | COc1cccc(C(=O)Oc2cncc(Cl)c2)c1 |
|
|
|
|
|
|
| 04000000 43000008 2000010a 00010200 00081000 c0000002 02000000 00000201 00010810 00080840 08140000 4000c040 00808002 22a00080 01200021 00082008 00000200 82008000 00482000 00020201 00000100 08000a00 05004000 08400410 00000000 c0000001 00000008 00800000 00000302 01024002 00020000 00000400 | 04008002 48000808 60004108 00010200 00041000 04004004 82080000 01200000 00000100 00000848 00000004 40048800 0680880e 08010002 01034007 220c000c 00020000 02002000 00280008 00020200 40000000 08028b20 30800000 00c09004 00002c00 80082200 00000200 00000000 00000200 00020000 c0000000 10020000 |