On Target ACE2_HUMAN 0.18796992/CHEMBL411298
For the given ligand ICV814, we have found in our database that, being scored 0.18796992, the most similar ligand is CHEMBL411298. Check out the elaboration below.
| ICV814 (Given Ligand) | CHEMBL411298 (Similar Ligand) |
|---|---|
| N#CC1/C=C\C=C/C1C5/C=C(C3/C=C(Cl)\C=C(OCC2/C=C\C=C/C2)/C3)\C(=O)N(C4/C=N\C=C/C4)C5 | CC(C)C[C@H](CP(=O)(O)[C@H]1CCCN1C(=O)OCc1ccccc1)C(=O)O |
|
|
|
|
|
|
| 00410052 89049000 08104000 80010d01 424d3000 04301401 10180180 30020402 11000008 021080c9 00230200 41419210 8402a122 09010000 02000404 0109110c 20c24804 40000340 40414082 0342a209 00002821 30041780 8100b400 0410081a 00700400 08008800 41484280 90040600 04004241 80040401 1c010800 46022280 | 01010000 01403600 00100104 00090600 00090002 0000c010 00a00000 000a0000 00000780 000008c0 81200081 40109000 04008032 030b0001 0a100008 021a0008 00022029 02580400 0040c8a0 02008401 00000000 19341f70 01411801 81400018 00008000 94002016 00000002 10214200 00040200 a0060301 d0040000 0400c203 |