Created at: Last updated at: Current status:
|
Name | ICV814 |
2D and 3D depictions | |
SMILES | N#CC1/C=C\C=C/C1C5/C=C(C3/C=C(Cl)\C=C(OCC2/C=C\C=C/C2)/C3)\C(=O)N(C4/C=N\C=C/C4)C5 |
Model downloads | |
Fingerprints |
Name | ICV813 |
2D and 3D depictions | |
SMILES | COCCO/C4=C/C(Cl)=C\C(\C3=C\C(C1/C=C\C=C/C1C#N)CN(C2/C=N\C=C/C2)C3=O)C4 |
Model downloads | |
Fingerprints |
Name | ICV816 |
2D and 3D depictions | |
SMILES | CO/C4=C/C(Cl)=C\C(\C3=C\C(c1c[nH]c(=O)[nH]c1=O)CN(C2/C=N\C=C/C2)C3=O)C4 |
Model downloads | |
Fingerprints |
Name | ICV815 |
2D and 3D depictions | |
SMILES | N#CC1/C=C\C=C/C1C5/C=C(C3/C=C(Cl)\C=C(OCCC2/C=C\C=C/C2)/C3)\C(=O)N(C4/C=N\C=C/C4)C5 |
Model downloads | |
Fingerprints |
Name | ICV812 |
2D and 3D depictions | |
SMILES | CCCO/C4=C/C(Cl)=C\C(\C3=C\C(C1/C=C\C=C/C1C#N)CN(C2/C=N\C=C/C2)C3=O)C4 |
Model downloads | |
Fingerprints |