On Target PA_INFA 0.31048387/CHEMBL2040602
For the given ligand ICV813, we have found in our database that, being scored 0.31048387, the most similar ligand is CHEMBL2040602. Check out the elaboration below.
| ICV813 (Given Ligand) | CHEMBL2040602 (Similar Ligand) |
|---|---|
| COCCO/C4=C/C(Cl)=C\C(\C3=C\C(C1/C=C\C=C/C1C#N)CN(C2/C=N\C=C/C2)C3=O)C4 | COc1ccc(/C=C2\N=C(CC(C)C)C(=O)N(O)C2=O)cc1 |
|
|
|
|
|
|
| 00410012 89049000 08104000 80010d01 424d3000 04301401 10180180 30020442 11002008 021080c9 00230000 41419200 8402a122 09010000 02000400 0009910c 20c24800 40000340 40414082 03422209 20002821 300407a0 85009400 0c10081a 00720400 08008800 41484280 90040620 04004201 80040401 1c010800 46022280 | 00412002 0100b018 60304108 00190e08 00029002 04000200 96140080 20a20410 03800002 22410cc1 00230000 4001b000 0410a006 08010002 03000003 00000018 e0000c00 52004300 00018002 11ce0209 00020001 38040600 80020001 06500818 02000080 80000000 404a2000 54050104 08400200 00068005 1c000000 02000200 |