On Target PR_HIV1 0.19791667/CHEMBL492666
For the given ligand ICV816, we have found in our database that, being scored 0.19791667, the most similar ligand is CHEMBL492666. Check out the elaboration below.
| ICV816 (Given Ligand) | CHEMBL492666 (Similar Ligand) |
|---|---|
| CO/C4=C/C(Cl)=C\C(\C3=C\C(c1c[nH]c(=O)[nH]c1=O)CN(C2/C=N\C=C/C2)C3=O)C4 | COc1ccc(S(=O)(=O)N(CC(C)C)C[C@@H](O)[C@H](Cc2ccccc2)NC(=O)OC2CCCCCC2)cc1 |
|
|
|
|
|
|
| 00410012 8904b000 09105000 83012f10 424db002 04b05401 10182180 20020416 17400188 029980e9 24a30004 41419200 8402a122 09410000 02200400 000c080c 20824800 02008340 40610082 43422209 00002801 10200780 a1809040 14100c1a 00740000 cc008800 61484080 90040600 04004201 80460401 5c010800 460222c0 | 00000010 01c05408 2110010a 01b10700 00081080 00028000 02000000 a0000004 00540a00 004809e0 08302000 60018000 00008002 00a00101 81e80001 001a0008 10822000 02080000 00402800 01027603 80000100 18280c90 03100040 d9500058 02000000 8000100e 00800000 1020108c 04000600 20060013 80020000 00012670 |