On Target PR_HIV1 0.1827957/CHEMBL494499
For the given ligand ICV813, we have found in our database that, being scored 0.1827957, the most similar ligand is CHEMBL494499. Check out the elaboration below.
| ICV813 (Given Ligand) | CHEMBL494499 (Similar Ligand) |
|---|---|
| COCCO/C4=C/C(Cl)=C\C(\C3=C\C(C1/C=C\C=C/C1C#N)CN(C2/C=N\C=C/C2)C3=O)C4 | COc1ccc(S(=O)(=O)N(CC(C)C)C[C@@H](O)[C@H](Cc2ccccc2)NC(=O)O[C@@H]2CCCCOC2)cc1 |
|
|
|
|
|
|
| 00410012 89049000 08104000 80010d01 424d3000 04301401 10180180 30020442 11002008 021080c9 00230000 41419200 8402a122 09010000 02000400 0009910c 20c24800 40000340 40414082 03422209 20002821 300407a0 85009400 0c10081a 00720400 08008800 41484280 90040620 04004201 80040401 1c010800 46022280 | 00000050 01c05409 2110050a 01b10700 00081080 00028000 02000000 a0000044 00542a00 004809e0 08342000 60018010 00008002 02a00101 81e80001 001a9008 10822000 02080000 00402800 01027603 80000120 18280c90 07100040 d9500058 02000400 8000100e 00800000 102000ec 04000600 20060013 80000000 00012670 |