On Target NS5B_HCV1A 0.22818792/CHEMBL3644934
For the given ligand ICV814, we have found in our database that, being scored 0.22818792, the most similar ligand is CHEMBL3644934. Check out the elaboration below.
| ICV814 (Given Ligand) | CHEMBL3644934 (Similar Ligand) |
|---|---|
| N#CC1/C=C\C=C/C1C5/C=C(C3/C=C(Cl)\C=C(OCC2/C=C\C=C/C2)/C3)\C(=O)N(C4/C=N\C=C/C4)C5 | CC(C)(C)OC(=O)N[C@H]1CCCCC/C=C\[C@@H]2C[C@@]2(C(=O)NS(=O)(=O)C2CC2)NC(=O)[C@@H]2CN(c3ccc(-c4ccccc4)cc3)CN2C1=O |
|
|
|
|
|
|
| 00410052 89049000 08104000 80010d01 424d3000 04301401 10180180 30020402 11000008 021080c9 00230200 41419210 8402a122 09010000 02000404 0109110c 20c24804 40000340 40414082 0342a209 00002821 30041780 8100b400 0410081a 00700400 08008800 41484280 90040600 04004241 80040401 1c010800 46022280 | 00016086 0d403c00 00100120 05310e00 20000000 00018000 000a0004 2000340b 10800200 00528be8 00202404 5101b000 0e02f00a 0104a001 80420440 001a8008 02064010 02482040 4c212850 02004a01 60100100 bc070e50 30028003 3254003a 02312000 80000002 00404000 902000ec 0c00c200 80060491 a41a4000 01016270 |