On Target NS5B_HCV1B 0.2359882/CHEMBL3645202
For the given ligand ICV816, we have found in our database that, being scored 0.2359882, the most similar ligand is CHEMBL3645202. Check out the elaboration below.
| ICV816 (Given Ligand) | CHEMBL3645202 (Similar Ligand) |
|---|---|
| CO/C4=C/C(Cl)=C\C(\C3=C\C(c1c[nH]c(=O)[nH]c1=O)CN(C2/C=N\C=C/C2)C3=O)C4 | CNC(=O)c1c2cc(C3CC3)c(N(CCCNC(=O)[C@H]3CCC[C@@H]3C(=O)OC)S(C)(=O)=O)cc2nn1-c1ccc(Br)cc1 |
|
|
|
|
|
|
| 00410012 8904b000 09105000 83012f10 424db002 04b05401 10182180 20020416 17400188 029980e9 24a30004 41419200 8402a122 09410000 02200400 000c080c 20824800 02008340 40610082 43422209 00002801 10200780 a1809040 14100c1a 00740000 cc008800 61484080 90040600 04004201 80460401 5c010800 460222c0 | 00074006 0180de08 20180902 41310f00 211c0000 00004042 02040000 22001408 00100900 004909e0 09312024 40119800 84008c3b 01c00201 808a0040 000e200e 04a68000 02000104 08602008 00225203 e0100101 1c8b8e38 2180c800 9370001c 02104080 c0000048 00270280 9000108c 0c488306 0146005b c4068088 a8916fe0 |