On Target NS5B_HCV1B 0.18844984/CHEMBL3645202
For the given ligand ICV813, we have found in our database that, being scored 0.18844984, the most similar ligand is CHEMBL3645202. Check out the elaboration below.
| ICV813 (Given Ligand) | CHEMBL3645202 (Similar Ligand) |
|---|---|
| COCCO/C4=C/C(Cl)=C\C(\C3=C\C(C1/C=C\C=C/C1C#N)CN(C2/C=N\C=C/C2)C3=O)C4 | CNC(=O)c1c2cc(C3CC3)c(N(CCCNC(=O)[C@H]3CCC[C@@H]3C(=O)OC)S(C)(=O)=O)cc2nn1-c1ccc(Br)cc1 |
|
|
|
|
|
|
| 00410012 89049000 08104000 80010d01 424d3000 04301401 10180180 30020442 11002008 021080c9 00230000 41419200 8402a122 09010000 02000400 0009910c 20c24800 40000340 40414082 03422209 20002821 300407a0 85009400 0c10081a 00720400 08008800 41484280 90040620 04004201 80040401 1c010800 46022280 | 00074006 0180de08 20180902 41310f00 211c0000 00004042 02040000 22001408 00100900 004909e0 09312024 40119800 84008c3b 01c00201 808a0040 000e200e 04a68000 02000104 08602008 00225203 e0100101 1c8b8e38 2180c800 9370001c 02104080 c0000048 00270280 9000108c 0c488306 0146005b c4068088 a8916fe0 |