On Target NP_HCoV-OC43 0.09049774/CHEMBL3233481
For the given ligand ICV814, we have found in our database that, being scored 0.09049774, the most similar ligand is CHEMBL3233481. Check out the elaboration below.
| ICV814 (Given Ligand) | CHEMBL3233481 (Similar Ligand) |
|---|---|
| N#CC1/C=C\C=C/C1C5/C=C(C3/C=C(Cl)\C=C(OCC2/C=C\C=C/C2)/C3)\C(=O)N(C4/C=N\C=C/C4)C5 | CN(C)CC(=O)Nc1ccc2[nH]c(=O)c3ccccc3c2c1.Cl |
|
|
|
|
|
|
| 00410052 89049000 08104000 80010d01 424d3000 04301401 10180180 30020402 11000008 021080c9 00230200 41419210 8402a122 09010000 02000404 0109110c 20c24804 40000340 40414082 0342a209 00002821 30041780 8100b400 0410081a 00700400 08008800 41484280 90040600 04004241 80040401 1c010800 46022280 | 00004002 00800000 00004020 00000600 00040000 00000060 00000000 00000000 06000000 40000a60 04280004 4000a000 00008800 00702000 00100040 00040004 00040000 00000008 08200000 00000004 40100000 28008608 20802000 80100002 00000000 40000000 00000000 00000080 08008000 00060001 00044000 00020200 |