On Target NP_HCoV-OC43 0.08597285/CHEMBL3233481
For the given ligand ICV813, we have found in our database that, being scored 0.08597285, the most similar ligand is CHEMBL3233481. Check out the elaboration below.
| ICV813 (Given Ligand) | CHEMBL3233481 (Similar Ligand) |
|---|---|
| COCCO/C4=C/C(Cl)=C\C(\C3=C\C(C1/C=C\C=C/C1C#N)CN(C2/C=N\C=C/C2)C3=O)C4 | CN(C)CC(=O)Nc1ccc2[nH]c(=O)c3ccccc3c2c1.Cl |
|
|
|
|
|
|
| 00410012 89049000 08104000 80010d01 424d3000 04301401 10180180 30020442 11002008 021080c9 00230000 41419200 8402a122 09010000 02000400 0009910c 20c24800 40000340 40414082 03422209 20002821 300407a0 85009400 0c10081a 00720400 08008800 41484280 90040620 04004201 80040401 1c010800 46022280 | 00004002 00800000 00004020 00000600 00040000 00000060 00000000 00000000 06000000 40000a60 04280004 4000a000 00008800 00702000 00100040 00040004 00040000 00000008 08200000 00000004 40100000 28008608 20802000 80100002 00000000 40000000 00000000 00000080 08008000 00060001 00044000 00020200 |