On Target PLP_SARS 0.28968254/CHEMBL212080
For the given ligand ICV813, we have found in our database that, being scored 0.28968254, the most similar ligand is CHEMBL212080. Check out the elaboration below.
| ICV813 (Given Ligand) | CHEMBL212080 (Similar Ligand) |
|---|---|
| COCCO/C4=C/C(Cl)=C\C(\C3=C\C(C1/C=C\C=C/C1C#N)CN(C2/C=N\C=C/C2)C3=O)C4 | CCOC(=O)/C=C/[C@H](C[C@@H]1CCNC1=O)NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](NC(=O)OCc1ccccc1)C(C)OC(C)(C)C |
|
|
|
|
|
|
| 00410012 89049000 08104000 80010d01 424d3000 04301401 10180180 30020442 11002008 021080c9 00230000 41419200 8402a122 09010000 02000400 0009910c 20c24800 40000340 40414082 03422209 20002821 300407a0 85009400 0c10081a 00720400 08008800 41484280 90040620 04004201 80040401 1c010800 46022280 | 01030000 0140f000 00100100 84010600 00040080 0023c810 02100080 28000408 01a00300 001088c0 40200000 4003b000 1e028002 00092001 80001408 021a0008 20220000 02080500 20812890 01001201 00002020 38040fb0 13008083 02500018 00001401 8800ac02 00c84800 90200120 08000200 00060001 ec004000 02802210 |