On Target NS3_HCV1A 0.26540285/CHEMBL3981499
For the given ligand ICV808, we have found in our database that, being scored 0.26540285, the most similar ligand is CHEMBL3981499. Check out the elaboration below.
| ICV808 (Given Ligand) | CHEMBL3981499 (Similar Ligand) |
|---|---|
| CNCc3ccc(/C2=C/C1/C=C(F)\C=C(C(N)=O)/C1O2)cc3 | C[C@@H](CC(N)=O)N[C@@H](c1ccc(Cl)c(C(=O)c2ccc(CO)cc2)c1F)C1CC1 |
|
|
|
|
|
|
| 00010082 41040000 00100300 000d0601 40050011 00205001 82000180 a2001400 01000100 001088c0 c0200200 40419210 94028800 200b4000 02000406 0a08040c 22200404 02000100 2089e090 00028201 01002021 5800d620 4140a020 a0400912 01401400 80002000 00486040 d0002020 00404340 004e0400 44060000 06000210 | 000080c0 01000c00 00100102 42050600 00000201 00004010 30000000 23001000 00000900 00080fc0 08300000 40009a00 0e008866 01201004 00000400 08080008 03000200 03000000 00000410 00000201 00000502 18028720 01000000 30400014 00003000 e0000200 08040000 d0800081 00000180 00068012 e4040000 00022600 |