Created at: Last updated at: Current status:
|
Name | ICV807 |
2D and 3D depictions | |
SMILES | O=C(OC4OC(OC(=O)c1cc(O)c(O)c(O)c1)C(OC(=O)c2cc(O)c(O)c(O)c2)C(OC(=O)c3cc(O)c(O)c(O)c3)C4OC(=O)c5cc(O)c(O)c(O)c5)c6cc(O)c(O)c(O)c6 |
Model downloads | |
Fingerprints |
Name | ICV811 |
2D and 3D depictions | |
SMILES | N#CC1/C=C\C=C/C1C4/C=C(C2/C=C(Cl)\C=C(Cl)/C2)\C(=O)N(C3/C=N\C=C/C3)C4 |
Model downloads | |
Fingerprints |
Name | ICV808 |
2D and 3D depictions | |
SMILES | CNCc3ccc(/C2=C/C1/C=C(F)\C=C(C(N)=O)/C1O2)cc3 |
Model downloads | |
Fingerprints |
Name | ICV809 |
2D and 3D depictions | |
SMILES | N#CC1/C=C\C=C/C1C4/C=C(C2/C=C\C=C(Cl)/C2)\C(=O)N(C3/C=N\C=C/C3)C4 |
Model downloads | |
Fingerprints |
Name | ICV810 |
2D and 3D depictions | |
SMILES | O=C3/C(C1/C=C\C=C(Cl)/C1)=C\C(c2c[nH]c(=O)[nH]c2=O)CN3C4/C=N\C=C/C4 |
Model downloads | |
Fingerprints |