On Target NS3_HCV1A 0.23853211/CHEMBL3645714
For the given ligand ICV811, we have found in our database that, being scored 0.23853211, the most similar ligand is CHEMBL3645714. Check out the elaboration below.
| ICV811 (Given Ligand) | CHEMBL3645714 (Similar Ligand) |
|---|---|
| N#CC1/C=C\C=C/C1C4/C=C(C2/C=C(Cl)\C=C(Cl)/C2)\C(=O)N(C3/C=N\C=C/C3)C4 | C=C[C@@H]1C[C@]1(NC(=O)[C@@H]1C[C@@]2(CN1C(=O)[C@@H](NC(=O)C(NC(=O)[C@@H]1SCCN1CC)C1CCCCC1)C(C)(C)C)C(C)(C)C21CCC1)C(=O)NS(=O)(=O)N1CCCC1 |
|
|
|
|
|
|
| 00430013 09049000 08104000 00000c00 42155000 04300401 50180180 30020402 11000000 02108089 00230000 41411200 0402a102 08010000 02000400 00000104 20404800 10800340 40010082 03420209 00402801 30040780 80009400 0410081a 00700000 08008800 41484280 900c0200 06000001 80040401 1c000000 46823280 | 000100a0 4d003000 26104000 0d300400 00010000 00000010 800a0000 20001408 10000000 0216c188 00602000 40013000 0601801e 010c2011 a0400400 00000000 04004400 00000200 46012000 00004209 00000000 30040632 00000203 36900038 10000000 00000000 00004000 90000050 08000000 c0040081 64024014 030122e0 |