On Target NS3_HCV1A 0.27586207/CHEMBL3894536
For the given ligand ICV810, we have found in our database that, being scored 0.27586207, the most similar ligand is CHEMBL3894536. Check out the elaboration below.
| ICV810 (Given Ligand) | CHEMBL3894536 (Similar Ligand) |
|---|---|
| O=C3/C(C1/C=C\C=C(Cl)/C1)=C\C(c2c[nH]c(=O)[nH]c2=O)CN3C4/C=N\C=C/C4 | CC[C@H](NC(=O)C1=CCCNC1)c1ccc(Cl)c(C(=O)c2cccnc2)c1F |
|
|
|
|
|
|
| 00430013 0904b000 01105000 03002e10 4215d002 04b04001 50182180 20020416 17400180 029980a9 24a30004 41411200 0402a102 08410000 02200400 000c0804 20004800 12808340 40610082 43420209 00002001 10200780 a0809040 14100c1a 00240000 cc000000 61484000 90040000 06004000 80460401 54000000 468232c0 | 080080d2 0880dc00 00104100 02010610 00041201 00000010 30182100 03001400 01400800 00180f60 08300004 40009a00 0a008966 00011004 00000400 080c020c 23010200 03000144 00210412 00000201 c0000500 18068780 21808000 3040001c 00043000 e0000200 084c0200 c0800181 00400180 01068413 a4040000 02022600 |