On Target ACE2_HUMAN 0.2451923/CHEMBL254495
For the given ligand ICV808, we have found in our database that, being scored 0.2451923, the most similar ligand is CHEMBL254495. Check out the elaboration below.
| ICV808 (Given Ligand) | CHEMBL254495 (Similar Ligand) |
|---|---|
| CNCc3ccc(/C2=C/C1/C=C(F)\C=C(C(N)=O)/C1O2)cc3 | CC[C@@H](C)[C@H](S)C(=O)N[C@@H](Cc1cccc(OCc2ccccc2)c1)C(=O)O |
|
|
|
|
|
|
| 00010082 41040000 00100300 000d0601 40050011 00205001 82000180 a2001400 01000100 001088c0 c0200200 40419210 94028800 200b4000 02000406 0a08040c 22200404 02000100 2089e090 00028201 01002021 5800d620 4140a020 a0400912 01401400 80002000 00486040 d0002020 00404340 004e0400 44060000 06000210 | 04010000 43005008 20100108 00110600 00001080 c0004000 82000000 20000004 00000980 020a08c0 08300000 4001b000 06808002 20050080 81080001 02080008 10000000 02000000 00480008 00020201 00000100 18200e20 03000140 85d01018 00000800 80002000 00000000 10000040 04000200 00060003 60004000 03012600 |