On Target PA_INFA 0.32286996/CHEMBL2040602
For the given ligand ICV811, we have found in our database that, being scored 0.32286996, the most similar ligand is CHEMBL2040602. Check out the elaboration below.
| ICV811 (Given Ligand) | CHEMBL2040602 (Similar Ligand) |
|---|---|
| N#CC1/C=C\C=C/C1C4/C=C(C2/C=C(Cl)\C=C(Cl)/C2)\C(=O)N(C3/C=N\C=C/C3)C4 | COc1ccc(/C=C2\N=C(CC(C)C)C(=O)N(O)C2=O)cc1 |
|
|
|
|
|
|
| 00430013 09049000 08104000 00000c00 42155000 04300401 50180180 30020402 11000000 02108089 00230000 41411200 0402a102 08010000 02000400 00000104 20404800 10800340 40010082 03420209 00402801 30040780 80009400 0410081a 00700000 08008800 41484280 900c0200 06000001 80040401 1c000000 46823280 | 00412002 0100b018 60304108 00190e08 00029002 04000200 96140080 20a20410 03800002 22410cc1 00230000 4001b000 0410a006 08010002 03000003 00000018 e0000c00 52004300 00018002 11ce0209 00020001 38040600 80020001 06500818 02000080 80000000 404a2000 54050104 08400200 00068005 1c000000 02000200 |