On Target PA_INFA 0.2919708/CHEMBL3600947
For the given ligand ICV807, we have found in our database that, being scored 0.2919708, the most similar ligand is CHEMBL3600947. Check out the elaboration below.
| ICV807 (Given Ligand) | CHEMBL3600947 (Similar Ligand) |
|---|---|
| O=C(OC4OC(OC(=O)c1cc(O)c(O)c(O)c1)C(OC(=O)c2cc(O)c(O)c(O)c2)C(OC(=O)c3cc(O)c(O)c(O)c3)C4OC(=O)c5cc(O)c(O)c(O)c5)c6cc(O)c(O)c(O)c6 | O=C(COc1ccc(F)cc1)c1ccc(O)c(O)c1O |
|
|
|
|
|
|
| 00000001 49000808 a0000509 00810b00 88280050 00004000 02002800 08002040 00202100 010008e8 04000000 40018000 00008002 02010000 00000000 222a9008 00820000 02000000 11408000 00020a01 00100020 18070a30 05000000 08500014 00000400 c0002000 004a0000 24000020 00000200 0002000a c0a00000 02000000 | 04001001 42000808 20110109 02010200 00001041 02020010 02000000 00000240 00000000 00080840 08040000 4000c100 00808002 00001000 01040001 2008a008 08000000 82000000 04000000 00420a00 00000000 08020200 01001000 00400014 00000000 80000000 00120008 00000001 00000200 00028002 80000000 00000600 |