On Target GP_EBOV 0.21428572/CHEMBL3125897
For the given ligand ICV809, we have found in our database that, being scored 0.21428572, the most similar ligand is CHEMBL3125897. Check out the elaboration below.
| ICV809 (Given Ligand) | CHEMBL3125897 (Similar Ligand) |
|---|---|
| N#CC1/C=C\C=C/C1C4/C=C(C2/C=C\C=C(Cl)/C2)\C(=O)N(C3/C=N\C=C/C3)C4 | CC(C)CCC[C@@H](C)[C@H]1CC[C@H]2[C@@H]3CC=C4C[C@@H](OC(=O)CSC[C@H](NC(=O)CNC(=O)[C@H](CO)NC(=O)CNC(=O)[C@H](CCCCN)NC(=O)[C@H](CCCCN)NC(=O)[C@H](CCCCN)NC(=O)[C@@H](N)CCCCN)C(=O)O)CC[C@]4(C)[C@H]3CC[C@@]21C |
|
|
|
|
|
|
| 00430013 09049000 00104000 00000c00 42155000 04300001 50180180 30020402 11000000 02108089 00230000 41411200 0402a102 08010000 02000400 00000104 20404800 10800340 40010082 03420209 00002001 30040780 80009400 0410081a 00200000 08000000 41484200 90040000 06000000 80040401 14000000 46823280 | 00010000 41007000 20120921 0c110700 00090080 00000020 00000000 2000040a 00000000 02144088 00203200 4001b000 1603800e 80842101 80100414 00081008 14820000 00000020 02c02000 00408301 00000020 30041e32 0300a683 06100018 18218601 00000010 00406000 90002040 08001200 01040023 24024000 07012200 |