On Target RT_HIV1 0.2244898/CHEMBL4225865
For the given ligand ICV809, we have found in our database that, being scored 0.2244898, the most similar ligand is CHEMBL4225865. Check out the elaboration below.
| ICV809 (Given Ligand) | CHEMBL4225865 (Similar Ligand) |
|---|---|
| N#CC1/C=C\C=C/C1C4/C=C(C2/C=C\C=C(Cl)/C2)\C(=O)N(C3/C=N\C=C/C3)C4 | C=C(C)[C@@H]1CC[C@]2(CN(CCN(C)C)C(=O)CCC(=O)O)CC[C@]3(C)[C@H](CC[C@@H]4[C@@]5(C)CC=C(c6ccc(C(=O)O)cc6)C(C)(C)[C@@H]5CC[C@]43C)[C@@H]12 |
|
|
|
|
|
|
| 00430013 09049000 00104000 00000c00 42155000 04300001 50180180 30020402 11000000 02108089 00230000 41411200 0402a102 08010000 02000400 00000104 20404800 10800340 40010082 03420209 00002001 30040780 80009400 0410081a 00200000 08000000 41484200 90040000 06000000 80040401 14000000 46823280 | 00060000 01003800 00100302 44050600 00100000 00004000 80000080 2000040a 00000900 001808c0 08300000 40019800 04028002 00202000 00000402 00080008 00000400 02000020 02412000 00000201 01000100 38060e30 01008021 0250001c 01200000 80000000 00406000 d0000000 08400002 01060003 e4020000 00802e00 |