On Target RT_HIV1 0.33333334/CHEMBL3787468
For the given ligand ICV808, we have found in our database that, being scored 0.33333334, the most similar ligand is CHEMBL3787468. Check out the elaboration below.
| ICV808 (Given Ligand) | CHEMBL3787468 (Similar Ligand) |
|---|---|
| CNCc3ccc(/C2=C/C1/C=C(F)\C=C(C(N)=O)/C1O2)cc3 | C=C(C)[C@@H]1CC[C@]2(C(=O)NCCN(C)C)CC[C@]3(C)[C@H](CC[C@@H]4[C@@]5(C)CC=C(c6ccc(C(=O)O)cc6)C(C)(C)[C@@H]5CC[C@]43C)[C@@H]12 |
|
|
|
|
|
|
| 00010082 41040000 00100300 000d0601 40050011 00205001 82000180 a2001400 01000100 001088c0 c0200200 40419210 94028800 200b4000 02000406 0a08040c 22200404 02000100 2089e090 00028201 01002021 5800d620 4140a020 a0400912 01401400 80002000 00486040 d0002020 00404340 004e0400 44060000 06000210 | 00010000 01002800 00100302 44050600 00000000 00004000 80000080 2000040a 00000900 001888c0 08300000 40019800 0402800a 00202000 00000402 00080008 00000400 02000020 02012000 00000201 01000100 38020e30 00008021 0250001c 01200000 80000000 00406000 d0000000 08400002 01060003 e4020000 00000600 |