On Target RT_HIV1 0.24675325/CHEMBL4228038
For the given ligand ICV807, we have found in our database that, being scored 0.24675325, the most similar ligand is CHEMBL4228038. Check out the elaboration below.
| ICV807 (Given Ligand) | CHEMBL4228038 (Similar Ligand) |
|---|---|
| O=C(OC4OC(OC(=O)c1cc(O)c(O)c(O)c1)C(OC(=O)c2cc(O)c(O)c(O)c2)C(OC(=O)c3cc(O)c(O)c(O)c3)C4OC(=O)c5cc(O)c(O)c(O)c5)c6cc(O)c(O)c(O)c6 | C=C(C)[C@@H]1CC[C@]2(CNCCCN(C)C)CC[C@]3(C)[C@H](CC[C@@H]4[C@@]5(C)CC=C(c6ccc(C(=O)O)cc6)C(C)(C)[C@@H]5CC[C@]43C)[C@@H]12 |
|
|
|
|
|
|
| 00000001 49000808 a0000509 00810b00 88280050 00004000 02002800 08002040 00202100 010008e8 04000000 40018000 00008002 02010000 00000000 222a9008 00820000 02000000 11408000 00020a01 00100020 18070a30 05000000 08500014 00000400 c0002000 004a0000 24000020 00000200 0002000a c0a00000 02000000 | 00000000 01000c00 00100302 40050600 00000000 00004000 80000080 20000402 00000900 001809e0 08300000 40018800 00028002 00200000 00000402 00080008 00000400 02000020 02012000 00000201 01000100 18020a30 00008020 00500014 01200000 80000000 00406000 d0000000 00400002 01060012 e4020000 00002600 |