On Target NS5B_HCV1A 0.24761905/CHEMBL348944
For the given ligand ICV808, we have found in our database that, being scored 0.24761905, the most similar ligand is CHEMBL348944. Check out the elaboration below.
| ICV808 (Given Ligand) | CHEMBL348944 (Similar Ligand) |
|---|---|
| CNCc3ccc(/C2=C/C1/C=C(F)\C=C(C(N)=O)/C1O2)cc3 | CCC(C)[C@H](NC(=O)OCc1ccc(C(=O)O)cc1)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CC(F)F)C(=O)C(=O)O |
|
|
|
|
|
|
| 00010082 41040000 00100300 000d0601 40050011 00205001 82000180 a2001400 01000100 001088c0 c0200200 40419210 94028800 200b4000 02000406 0a08040c 22200404 02000100 2089e090 00028201 01002021 5800d620 4140a020 a0400912 01401400 80002000 00486040 d0002020 00404340 004e0400 44060000 06000210 | 01010000 01403800 00100100 44050600 00081000 0001c000 00000000 20000008 04800300 000008c0 00200000 4001f000 0e008002 00012001 80000000 021a0408 000a0000 02080401 00c00890 00000201 00000000 38160e70 01000083 0250001c 00001001 80002082 00000060 90200020 08000200 02060001 e0004000 00002200 |