On Target NS5B_HCV1A 0.23529412/CHEMBL3659510
For the given ligand ICV811, we have found in our database that, being scored 0.23529412, the most similar ligand is CHEMBL3659510. Check out the elaboration below.
| ICV811 (Given Ligand) | CHEMBL3659510 (Similar Ligand) |
|---|---|
| N#CC1/C=C\C=C/C1C4/C=C(C2/C=C(Cl)\C=C(Cl)/C2)\C(=O)N(C3/C=N\C=C/C3)C4 | CCC[C@H](NC(=O)[C@@H]1[C@H]2[C@H]3C=C[C@H](C3)[C@H]2CN1C(=O)[C@@H](NC(=O)[C@@H](NC(=O)c1cnccn1)C1CCCCC1)C(C)(C)C)C(=O)C(=O)NC1CC1 |
|
|
|
|
|
|
| 00430013 09049000 08104000 00000c00 42155000 04300401 50180180 30020402 11000000 02108089 00230000 41411200 0402a102 08010000 02000400 00000104 20404800 10800340 40010082 03420209 00402801 30040780 80009400 0410081a 00700000 08008800 41484280 900c0200 06000001 80040401 1c000000 46823280 | 10018002 01803400 00100800 14000c10 00000040 00100010 0000c000 2000340b 14000000 001181a0 01290000 40013000 0e02801a 01102001 80820400 00040104 08024000 02000023 02012010 00000201 80000000 300f8e30 2100c003 02100018 00341000 00200000 08404000 90000004 0c000004 01060811 a4024000 80002200 |