On Target NS5B_HCV1B 0.22018349/CHEMBL3422106
For the given ligand ICV810, we have found in our database that, being scored 0.22018349, the most similar ligand is CHEMBL3422106. Check out the elaboration below.
| ICV810 (Given Ligand) | CHEMBL3422106 (Similar Ligand) |
|---|---|
| O=C3/C(C1/C=C\C=C(Cl)/C1)=C\C(c2c[nH]c(=O)[nH]c2=O)CN3C4/C=N\C=C/C4 | CC(C)N1CCC(N(C)C(=O)Cn2c(-c3ccccc3)c(C3CCCCC3)c3sc(C(=O)O)cc32)C1 |
|
|
|
|
|
|
| 00430013 0904b000 01105000 03002e10 4215d002 04b04001 50182180 20020416 17400180 029980a9 24a30004 41411200 0402a102 08410000 02200400 000c0804 20004800 12808340 40610082 43420209 00002001 10200780 a0809040 14100c1a 00240000 cc000000 61484000 90040000 06004000 80460401 54000000 468232c0 | 000360c2 2d003c01 00100912 55810618 201e5121 0000c110 00002080 2009400c 20600900 100809e0 08300a04 4003a080 8800881a 00e0b801 204a3d20 0c0c000c 11134000 c280209c 06202400 00514213 00102100 788e8ef0 30904083 9250001e 0a842001 c4000009 08010000 90000044 0a044c06 00061453 c0020a40 00c11e20 |