On Target NA_INFB 0.4207317/CHEMBL420120
For the given ligand ICV809, we have found in our database that, being scored 0.4207317, the most similar ligand is CHEMBL420120. Check out the elaboration below.
| ICV809 (Given Ligand) | CHEMBL420120 (Similar Ligand) |
|---|---|
| N#CC1/C=C\C=C/C1C4/C=C(C2/C=C\C=C(Cl)/C2)\C(=O)N(C3/C=N\C=C/C3)C4 | CCCN(CCC)[C@@H]1C=C(C(=O)O)C[C@H](N)[C@H]1NC(C)=O |
|
|
|
|
|
|
| 00430013 09049000 00104000 00000c00 42155000 04300001 50180180 30020402 11000000 02108089 00230000 41411200 0402a102 08010000 02000400 00000104 20404800 10800340 40010082 03420209 00002001 30040780 80009400 0410081a 00200000 08000000 41484200 90040000 06000000 80040401 14000000 46823280 | 00030010 0900b400 00100000 04000400 00180000 00000000 00180180 3800040a 11000000 00100188 00200000 41011000 0402811a 01812000 00000400 00080308 20004000 00000160 40412010 00000201 00000000 30040f90 01008001 02100018 00001000 08008c00 00484000 90000000 0c000000 00040411 04020000 02002200 |