On Target NA_INFB 0.33482143/CHEMBL113191
For the given ligand ICV810, we have found in our database that, being scored 0.33482143, the most similar ligand is CHEMBL113191. Check out the elaboration below.
| ICV810 (Given Ligand) | CHEMBL113191 (Similar Ligand) |
|---|---|
| O=C3/C(C1/C=C\C=C(Cl)/C1)=C\C(c2c[nH]c(=O)[nH]c2=O)CN3C4/C=N\C=C/C4 | CC(=O)N[C@@H]1[C@@H](N)CC(C(=O)O)=C[C@H]1N(C)CCc1ccccc1 |
|
|
|
|
|
|
| 00430013 0904b000 01105000 03002e10 4215d002 04b04001 50182180 20020416 17400180 029980a9 24a30004 41411200 0402a102 08410000 02200400 000c0804 20004800 12808340 40610082 43420209 00002001 10200780 a0809040 14100c1a 00240000 cc000000 61484000 90040000 06004000 80460401 54000000 468232c0 | 00030010 0900b400 00100100 04010600 00180000 00000000 00180180 3800040a 11000080 001809c8 08200000 41019000 0402811a 01812000 00000400 00080308 20004000 02000160 40412010 00000201 00000000 38240f90 01008001 83500018 00001000 88008c00 00484000 90000000 0c000000 00060413 04020000 02002600 |