On Target RDRP_SARS2 0.1815562/CHEMBL4065616
For the given ligand ICV808, we have found in our database that, being scored 0.1815562, the most similar ligand is CHEMBL4065616. Check out the elaboration below.
| ICV808 (Given Ligand) | CHEMBL4065616 (Similar Ligand) |
|---|---|
| CNCc3ccc(/C2=C/C1/C=C(F)\C=C(C(N)=O)/C1O2)cc3 | CCC(COC(=O)[C@@H](NP(=O)(Oc1ccccc1)OC[C@H]1O[C@@]([C@@H]([C@@H]1O)O)(C#N)c1ccc2n1ncnc2N)C)CC |
|
|
|
|
|
|
| 00010082 41040000 00100300 000d0601 40050011 00205001 82000180 a2001400 01000100 001088c0 c0200200 40419210 94028800 200b4000 02000406 0a08040c 22200404 02000100 2089e090 00028201 01002021 5800d620 4140a020 a0400912 01401400 80002000 00486040 d0002020 00404340 004e0400 44060000 06000210 | 0020004a 81144109 f2103512 99010f60 452c80f4 8008c004 0303c401 00200a20 19404b00 010c0844 08189004 4ac7b168 00009802 02b30020 000e9040 028eba8c 084b8830 06800005 21662008 00665243 60120120 3e008a60 a7801cc6 08700110 10000400 80002000 0f0892c0 900388a0 0240128f 00c6cc36 55400280 22339c84 |