On Target NSP15_SARS 0.24855492/CHEMBL2441741
For the given ligand ICV807, we have found in our database that, being scored 0.24855492, the most similar ligand is CHEMBL2441741. Check out the elaboration below.
| ICV807 (Given Ligand) | CHEMBL2441741 (Similar Ligand) |
|---|---|
| O=C(OC4OC(OC(=O)c1cc(O)c(O)c(O)c1)C(OC(=O)c2cc(O)c(O)c(O)c2)C(OC(=O)c3cc(O)c(O)c(O)c3)C4OC(=O)c5cc(O)c(O)c(O)c5)c6cc(O)c(O)c(O)c6 | CC(C)C[C@H](NC(=O)[C@H](Cc1cccc2ccccc12)NC(=O)OCc1ccccc1)C(=O)N[C@H](C=O)C[C@@H]1CCNC1=O |
|
|
|
|
|
|
| 00000001 49000808 a0000509 00810b00 88280050 00004000 02002800 08002040 00202100 010008e8 04000000 40018000 00008002 02010000 00000000 222a9008 00820000 02000000 11408000 00020a01 00100020 18070a30 05000000 08500014 00000400 c0002000 004a0000 24000020 00000200 0002000a c0a00000 02000000 | 01030000 01403200 00100100 04010600 00000000 0001c010 00000000 2000000c 00e00b00 000a08c0 08300000 4003b000 0e00801a 00012001 80000000 021e0008 00020000 02080400 00002898 00000201 00000100 38240e38 00000003 83500018 00000800 80002002 00000000 10200020 0c000200 0006000b e0004000 00802600 |