On Target NP_HCoV-OC43 0.094444446/CHEMBL3233481
For the given ligand ICV809, we have found in our database that, being scored 0.094444446, the most similar ligand is CHEMBL3233481. Check out the elaboration below.
| ICV809 (Given Ligand) | CHEMBL3233481 (Similar Ligand) |
|---|---|
| N#CC1/C=C\C=C/C1C4/C=C(C2/C=C\C=C(Cl)/C2)\C(=O)N(C3/C=N\C=C/C3)C4 | CN(C)CC(=O)Nc1ccc2[nH]c(=O)c3ccccc3c2c1.Cl |
|
|
|
|
|
|
| 00430013 09049000 00104000 00000c00 42155000 04300001 50180180 30020402 11000000 02108089 00230000 41411200 0402a102 08010000 02000400 00000104 20404800 10800340 40010082 03420209 00002001 30040780 80009400 0410081a 00200000 08000000 41484200 90040000 06000000 80040401 14000000 46823280 | 00004002 00800000 00004020 00000600 00040000 00000060 00000000 00000000 06000000 40000a60 04280004 4000a000 00008800 00702000 00100040 00040004 00040000 00000008 08200000 00000004 40100000 28008608 20802000 80100002 00000000 40000000 00000000 00000080 08008000 00060001 00044000 00020200 |