On Target PLP_SARS 0.25714287/CHEMBL213543
For the given ligand ICV810, we have found in our database that, being scored 0.25714287, the most similar ligand is CHEMBL213543. Check out the elaboration below.
| ICV810 (Given Ligand) | CHEMBL213543 (Similar Ligand) |
|---|---|
| O=C3/C(C1/C=C\C=C(Cl)/C1)=C\C(c2c[nH]c(=O)[nH]c2=O)CN3C4/C=N\C=C/C4 | CCOC(=O)/C=C/[C@H](C[C@@H]1CCNC1=O)NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](NC(=O)OCc1ccccc1)C(C)C |
|
|
|
|
|
|
| 00430013 0904b000 01105000 03002e10 4215d002 04b04001 50182180 20020416 17400180 029980a9 24a30004 41411200 0402a102 08410000 02200400 000c0804 20004800 12808340 40610082 43420209 00002001 10200780 a0809040 14100c1a 00240000 cc000000 61484000 90040000 06004000 80460401 54000000 468232c0 | 01030000 0140b000 00100100 04010600 00000000 0001c810 02100080 28000408 01a00300 001088c0 40200000 4003b000 0e028002 00012001 80000400 021a0008 20020000 02080500 20012890 00001201 00002000 38040fb0 00008003 02500018 00001400 8800ac02 00484000 90200120 08000200 00060001 ec004000 02802210 |