On Target NSP1_SARS 0.28313252/CHEMBL1092796
For the given ligand ICV808, we have found in our database that, being scored 0.28313252, the most similar ligand is CHEMBL1092796. Check out the elaboration below.
| ICV808 (Given Ligand) | CHEMBL1092796 (Similar Ligand) |
|---|---|
| CNCc3ccc(/C2=C/C1/C=C(F)\C=C(C(N)=O)/C1O2)cc3 | CC1=CC[C@]2(C)CC[C@]3(C)C4=CC=C5C(=CC(=O)C(O)=C5C)[C@]4(C)CC[C@@]3(C)[C@@H]2C1 |
|
|
|
|
|
|
| 00010082 41040000 00100300 000d0601 40050011 00205001 82000180 a2001400 01000100 001088c0 c0200200 40419210 94028800 200b4000 02000406 0a08040c 22200404 02000100 2089e090 00028201 01002021 5800d620 4140a020 a0400912 01401400 80002000 00486040 d0002020 00404340 004e0400 44060000 06000210 | 00000402 01040000 00000800 00080000 40402000 00000001 00000080 02000402 01000000 00100000 00000200 40404200 80028000 20000000 00000404 0008040c 00000000 00000020 02092080 00020001 00002001 00000280 01008000 00000812 00200000 00000000 00404240 80800000 00004000 00000000 24820000 04000000 |