On Target PR_HIV1 0.2113402/CHEMBL523528
For the given ligand ICV803, we have found in our database that, being scored 0.2113402, the most similar ligand is CHEMBL523528. Check out the elaboration below.
| ICV803 (Given Ligand) | CHEMBL523528 (Similar Ligand) |
|---|---|
| C[C@H](c1cccc2ccccc12)N4CCC(C(=O)NCc3cccc(NC(=O)CN(C)C)c3)CC4 | COc1ccc(S(=O)(=O)N(CC(C)C)C[C@@H](O)[C@H](Cc2ccccc2)NC(=O)OC2COCOC2)cc1 |
|
|
|
|
|
|
| 10024002 01800000 40100120 00010600 04000000 08000000 00000000 22001000 00a00000 00080ad0 08280004 5003b000 04008802 00102000 00000440 00000000 00040000 02000000 08000000 00000201 c0100000 38008608 20002000 0050001a 00040000 c0000000 00000000 90000080 08408100 00060003 20044000 00800600 | 00000010 01c05409 2110050a 01b10600 00081080 00028000 02802800 20000004 00742a00 014809e0 08302000 60018010 00008002 00200001 81e80001 003a0008 10022000 02080000 01400800 01027603 80100100 18280c90 07100040 d9500058 02000000 8000000e 00800000 342000cc 04000600 20060013 80000000 00012670 |