Created at: Last updated at: Current status:
|
Name | ICV805 |
2D and 3D depictions | |
SMILES | C[C@H](c1cccc2ccccc12)N4CCC(C(=O)NCc3cc(F)cc(NC(=O)CN(C)C)c3)CC4 |
Model downloads | |
Fingerprints |
Name | ICV804 |
2D and 3D depictions | |
SMILES | C[C@H](c1cccc2ccccc12)N5CCC(C(=O)NCc4cccc(NC(=O)N3CCN(C)CC3)c4)CC5 |
Model downloads | |
Fingerprints |
Name | ICV802 |
2D and 3D depictions | |
SMILES | C[C@H](c1cccc2ccccc12)N4CCC(C(=O)NCC3CCN(C)CC3)CC4 |
Model downloads | |
Fingerprints |
Name | ICV806 |
2D and 3D depictions | |
SMILES | C[C@H](c1cccc2ccccc12)N5CCC(C(=O)NCc4cc(F)cc(NC(=O)N3CCN(C)CC3)c4)CC5 |
Model downloads | |
Fingerprints |
Name | ICV803 |
2D and 3D depictions | |
SMILES | C[C@H](c1cccc2ccccc12)N4CCC(C(=O)NCc3cccc(NC(=O)CN(C)C)c3)CC4 |
Model downloads | |
Fingerprints |