On Target NS5B_HCV1A 0.33526012/CHEMBL3644925
For the given ligand ICV803, we have found in our database that, being scored 0.33526012, the most similar ligand is CHEMBL3644925. Check out the elaboration below.
| ICV803 (Given Ligand) | CHEMBL3644925 (Similar Ligand) |
|---|---|
| C[C@H](c1cccc2ccccc12)N4CCC(C(=O)NCc3cccc(NC(=O)CN(C)C)c3)CC4 | CCC[C@H](NC(=O)[C@@H]1CN(c2ccc(-c3ccccc3)cc2)CN1C(=O)[C@@H](NC(=O)OC1CCCC1)C(C)(C)C)C(=O)C(=O)NC1CC1 |
|
|
|
|
|
|
| 10024002 01800000 40100120 00010600 04000000 08000000 00000000 22001000 00a00000 00080ad0 08280004 5003b000 04008802 00102000 00000440 00000000 00040000 02000000 08000000 00000201 c0100000 38008608 20002000 0050001a 00040000 c0000000 00000000 90000080 08408100 00060003 20044000 00800600 | 00016006 01403c00 00100120 04010f00 20080000 00018000 00000004 a0002009 04800200 00020be0 00200004 5001b000 0e00b00a 0100a101 80020040 001a0008 00860010 02482001 0c402850 00000a01 60100100 380f0e10 31020003 0250001a 00113000 80001002 00000000 102000e0 0800c200 01060013 a0184000 00006200 |