On Target NS5B_HCV1A 0.36898395/CHEMBL3644925
For the given ligand ICV806, we have found in our database that, being scored 0.36898395, the most similar ligand is CHEMBL3644925. Check out the elaboration below.
| ICV806 (Given Ligand) | CHEMBL3644925 (Similar Ligand) |
|---|---|
| C[C@H](c1cccc2ccccc12)N5CCC(C(=O)NCc4cc(F)cc(NC(=O)N3CCN(C)CC3)c4)CC5 | CCC[C@H](NC(=O)[C@@H]1CN(c2ccc(-c3ccccc3)cc2)CN1C(=O)[C@@H](NC(=O)OC1CCCC1)C(C)(C)C)C(=O)C(=O)NC1CC1 |
|
|
|
|
|
|
| 10020006 01802000 00100100 06010e00 04000100 08000010 00000004 22003009 08a00000 000a68d0 08280004 70039000 0401a802 08103000 00000460 00000000 00040010 02400000 08000000 00000201 c0000100 38018608 20022020 02500018 00140000 c0000001 00000000 90000081 08408100 00068003 20040000 00804600 | 00016006 01403c00 00100120 04010f00 20080000 00018000 00000004 a0002009 04800200 00020be0 00200004 5001b000 0e00b00a 0100a101 80020040 001a0008 00860010 02482001 0c402850 00000a01 60100100 380f0e10 31020003 0250001a 00113000 80001002 00000000 102000e0 0800c200 01060013 a0184000 00006200 |