On Target PR_SARS 0.34228188/CHEMBL2441741
For the given ligand ICV803, we have found in our database that, being scored 0.34228188, the most similar ligand is CHEMBL2441741. Check out the elaboration below.
| ICV803 (Given Ligand) | CHEMBL2441741 (Similar Ligand) |
|---|---|
| C[C@H](c1cccc2ccccc12)N4CCC(C(=O)NCc3cccc(NC(=O)CN(C)C)c3)CC4 | CC(C)C[C@H](NC(=O)[C@H](Cc1cccc2ccccc12)NC(=O)OCc1ccccc1)C(=O)N[C@H](C=O)C[C@@H]1CCNC1=O |
|
|
|
|
|
|
| 10024002 01800000 40100120 00010600 04000000 08000000 00000000 22001000 00a00000 00080ad0 08280004 5003b000 04008802 00102000 00000440 00000000 00040000 02000000 08000000 00000201 c0100000 38008608 20002000 0050001a 00040000 c0000000 00000000 90000080 08408100 00060003 20044000 00800600 | 01030000 01403200 00100100 04010600 00000000 0001c010 00000000 2000000c 00e00b00 000a08c0 08300000 4003b000 0e00801a 00012001 80000000 021e0008 00020000 02080400 00002898 00000201 00000100 38240e38 00000003 83500018 00000800 80002002 00000000 10200020 0c000200 0006000b e0004000 00802600 |