On Target NS3_HCV1A 0.23529412/CHEMBL4110238
For the given ligand 3, we have found in our database that, being scored 0.23529412, the most similar ligand is CHEMBL4110238. Check out the elaboration below.
| 3 (Given Ligand) | CHEMBL4110238 (Similar Ligand) |
|---|---|
| CCOC(=O)/C=C/c1ccc(O)c(OC)c1 | CC[C@@H](N[C@H](C)CC(N)=O)c1ccc(OC)c(C(=O)c2ccccc2)c1F |
|
|
|
|
|
|
| 00000000 40000008 20000108 00010200 00001000 00000000 82000080 00000400 01800000 00000840 40000000 40108000 0400c002 00000000 01000003 00088008 00020400 02000000 20098018 00020200 00000000 08000a00 00000001 00400000 00001400 80000000 00422000 40000400 00400200 00020100 04000000 00000110 | 000000c0 00000c08 20100108 02010600 00001201 00020010 12040000 03001200 00000800 00088fc0 08300000 40009200 0c008842 00001000 01000401 08082008 03000200 02000000 00000410 00020201 00000100 18028600 01000000 32400014 00001000 e0000000 08320800 c0800001 00000380 00068012 a2040010 00002600 |