|
Name | 3 |
2D and 3D depictions | |
SMILES | CCOC(=O)/C=C/c1ccc(O)c(OC)c1 |
Model downloads | |
Fingerprints |
Name | 5 |
2D and 3D depictions | |
SMILES | O=c3cc(c1ccc(O)c(O)c1)oc4cc(O)cc(OC2OC(CO)C(O)C(O)C2O)c34 |
Model downloads | |
Fingerprints |
Name | 4 |
2D and 3D depictions | |
SMILES | COc1cc(/C=C/C(=O)O)ccc1O |
Model downloads | |
Fingerprints |
Name | 2 |
2D and 3D depictions | |
SMILES | CC1COc3c1c(=O)c(=O)c4c2CCCC(C)(C)c2ccc34 |
Model downloads | |
Fingerprints |
Name | 1 |
2D and 3D depictions | |
SMILES | O=C(/C=C/c1ccc(O)c(O)c1)OC2CC(O)(C(=O)O)CC(O)C2O |
Model downloads | |
Fingerprints |